CAS 2650-35-3 is the registry number for Nor Securinine. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,8S,13R)-2-oxa-9-azatetracyclo[6.5.1.01,5.09,13]tetradeca-4,6-dien-3-one (CAS 2650-35-3) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: (1S,8S,13R)-2-oxa-9-azatetracyclo[6.5.1.01,5.09,13]tetradeca-4,6-dien-3-one. InChIKey: NBGOALXYAZVRPS-FOGDFJRCSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (1S,8S,13R)-2-oxa-9-azatetracyclo[6.5.1.01,5.09,13]tetradeca-4,6-dien-3-one |
| InChIKey | NBGOALXYAZVRPS-FOGDFJRCSA-N |
| SMILES | C1C[C@@H]2[C@]34C[C@H](N2C1)C=CC3=CC(=O)O4 |
Computed by PubChem (NCBI)