CAS 2650519-91-6 is the registry number for 3,6-Di-tert-butyl-9H-carbazole-d6. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,6-ditert-butyl-1,2,4,5,7,8-hexadeuterio-9H-carbazole (CAS 2650519-91-6) is a chemical compound with the molecular formula C20H25N and a molecular weight of 285.5 g/mol. IUPAC name: 3,6-ditert-butyl-1,2,4,5,7,8-hexadeuterio-9H-carbazole. InChIKey: OYFFSPILVQLRQA-HHVDATSVSA-N.
| Molecular formula | C20H25N |
|---|---|
| Molecular weight | 285.5 g/mol |
| IUPAC name | 3,6-ditert-butyl-1,2,4,5,7,8-hexadeuterio-9H-carbazole |
| InChIKey | OYFFSPILVQLRQA-HHVDATSVSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C1C(C)(C)C)[2H])C3=C(N2)C(=C(C(=C3[2H])C(C)(C)C)[2H])[2H])[2H] |
Computed by PubChem (NCBI)