CAS 878973-28-5 appears in our catalog under these names: 6-Ethyl-2,2,4-trimethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 95%, 6-Ethyl-2,2,4-trimethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-ethyl-2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline (CAS 878973-28-5) is a chemical compound with the molecular formula C20H25N and a molecular weight of 279.4 g/mol. IUPAC name: 6-ethyl-2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline. InChIKey: ASQMKMDDYIPRCG-UHFFFAOYSA-N.
| Molecular formula | C20H25N |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | 6-ethyl-2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline |
| InChIKey | ASQMKMDDYIPRCG-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC(CC2(C)C3=CC=CC=C3)(C)C |
Computed by PubChem (NCBI)