CAS 26510-95-2 appears in our catalog under these names: Ethyl (4-bromobenzoyl)acetate, 95%, Ethyl (4–bromobenzoyl)acetate, Ethyl (4-Bromobenzoyl)acetate, >98.0%(GC), Ethyl 3-(4-bromophenyl)-3-oxo-propanoate, 98%, 98%, 3-(4-Bromophenyl)-3-oxo-propionic acid ethylester, 95%. Offered by: Thermo Scientific (Acros), GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 25g, 10g, 500g, 20g.
Ethyl 3-(4-bromophenyl)-3-oxopropanoate (CAS 26510-95-2) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: ethyl 3-(4-bromophenyl)-3-oxopropanoate. InChIKey: PBDYXCKRDRCJDC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | ethyl 3-(4-bromophenyl)-3-oxopropanoate |
| InChIKey | PBDYXCKRDRCJDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)