CAS 2654792-86-4 is the registry number for 2-Bromo-3,6,6-trimethyl-6,7-dihydrobenzofuran-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-one (CAS 2654792-86-4) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 2-bromo-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-one. InChIKey: KCMCYNHZNQXIKO-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-bromo-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-one |
| InChIKey | KCMCYNHZNQXIKO-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C(=O)CC(C2)(C)C)Br |
Computed by PubChem (NCBI)