CAS 26584-20-3 appears in our catalog under these names: Methyl 3-bromo-2,4,6-trimethylbenzoate, Methyl 3-bromo-2,4,6-trimethylbenzoate, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Methyl 3-bromo-2,4,6-trimethylbenzoate (CAS 26584-20-3) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: methyl 3-bromo-2,4,6-trimethylbenzoate. InChIKey: YUFSUAINJIKSAG-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | methyl 3-bromo-2,4,6-trimethylbenzoate |
| InChIKey | YUFSUAINJIKSAG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)C)Br)C |
Computed by PubChem (NCBI)