Products 2658494-11-0

CAS 2658494-11-0 is the registry number for 2-Bromo-5-ethoxyisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-5-ethoxypyridine-4-carboxylic acid (CAS 2658494-11-0) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-bromo-5-ethoxypyridine-4-carboxylic acid. InChIKey: DWSHHWMRTVLJFD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO3
Molecular weight246.06 g/mol
IUPAC name2-bromo-5-ethoxypyridine-4-carboxylic acid
InChIKeyDWSHHWMRTVLJFD-UHFFFAOYSA-N
SMILESCCOC1=CN=C(C=C1C(=O)O)Br

Computed by PubChem (NCBI)