Products 26586-50-5
CAS 26586-50-5 is the registry number for 4-Acetamido-3-chloro-hydratropic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 500mg.
Ethyl 2-(4-acetamido-3-chlorophenyl)propanoate (CAS 26586-50-5) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: ethyl 2-(4-acetamido-3-chlorophenyl)propanoate. InChIKey: JRLLKLDNWBDTKN-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | ethyl 2-(4-acetamido-3-chlorophenyl)propanoate |
| InChIKey | JRLLKLDNWBDTKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CC(=C(C=C1)NC(=O)C)Cl |
Computed by PubChem (NCBI)