CAS 2660255-82-1 is the registry number for 4,7-Dichloro-1-isopropylpyrido[3,4-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dichloro-1-propan-2-ylpyrido[3,4-d]pyridazine (CAS 2660255-82-1) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 4,7-dichloro-1-propan-2-ylpyrido[3,4-d]pyridazine. InChIKey: ZPEBSNAUYXOFCX-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 4,7-dichloro-1-propan-2-ylpyrido[3,4-d]pyridazine |
| InChIKey | ZPEBSNAUYXOFCX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN=C(C2=CN=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)