CAS 956438-99-6 is the registry number for 1-((2,6-Dichlorophenyl)methyl)-1H-pyrazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(2,6-dichlorophenyl)methyl]pyrazol-3-amine (CAS 956438-99-6) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)methyl]pyrazol-3-amine. InChIKey: RBBUZPGMZQSXCP-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)methyl]pyrazol-3-amine |
| InChIKey | RBBUZPGMZQSXCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN2C(=CC=N2)N)Cl |
Computed by PubChem (NCBI)