Products 744972-57-4
CAS 744972-57-4 is the registry number for N-((1H-Imidazol-2-yl)methyl)-3,4-dichloroaniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-N-(1H-imidazol-2-ylmethyl)aniline (CAS 744972-57-4) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 3,4-dichloro-N-(1H-imidazol-2-ylmethyl)aniline. InChIKey: UVMYKKFOHJRNTG-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 3,4-dichloro-N-(1H-imidazol-2-ylmethyl)aniline |
| InChIKey | UVMYKKFOHJRNTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NCC2=NC=CN2)Cl)Cl |
Computed by PubChem (NCBI)