CAS 2660998-86-5 is the registry number for 4-Methoxy-2,2,6-trimethyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-2,2,6-trimethyl-3H-inden-1-one (CAS 2660998-86-5) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 4-methoxy-2,2,6-trimethyl-3H-inden-1-one. InChIKey: FVOOKGYBZKDBSB-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 4-methoxy-2,2,6-trimethyl-3H-inden-1-one |
| InChIKey | FVOOKGYBZKDBSB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CC(C2=O)(C)C)C(=C1)OC |
Computed by PubChem (NCBI)