Products 2662756-69-4
CAS 2662756-69-4 is the registry number for Isoprocarb-d3. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg.
(2-propan-2-ylphenyl) N-(trideuteriomethyl)carbamate (CAS 2662756-69-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 196.26 g/mol. IUPAC name: (2-propan-2-ylphenyl) N-(trideuteriomethyl)carbamate. InChIKey: QBSJMKIUCUGGNG-HPRDVNIFSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 196.26 g/mol |
| IUPAC name | (2-propan-2-ylphenyl) N-(trideuteriomethyl)carbamate |
| InChIKey | QBSJMKIUCUGGNG-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC=CC=C1C(C)C |
Computed by PubChem (NCBI)