Products 266359-63-1
CAS 266359-63-1 appears in our catalog under these names: 6-Chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one, 97%, 6-Chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
6-chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one (CAS 266359-63-1) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 6-chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one. InChIKey: RZYWXQQLMVXGQY-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 6-chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | RZYWXQQLMVXGQY-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC2=C1C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)