Products 2663622-29-3
CAS 2663622-29-3 is the registry number for 1-(2,3,5-Trichloropyridin-4-yl)ethanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3,5-trichloro-4-pyridinyl)ethanol (CAS 2663622-29-3) is a chemical compound with the molecular formula C7H6Cl3NO and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,3,5-trichloro-4-pyridinyl)ethanol. InChIKey: BXBDJMADUAQMIY-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3NO |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(2,3,5-trichloro-4-pyridinyl)ethanol |
| InChIKey | BXBDJMADUAQMIY-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=NC=C1Cl)Cl)Cl)O |
Computed by PubChem (NCBI)