Products 2665660-81-9
CAS 2665660-81-9 is the registry number for Methyl 6-hydroxy-1H-indazole-5-carboxylate. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 6-hydroxy-1H-indazole-5-carboxylate (CAS 2665660-81-9) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 6-hydroxy-1H-indazole-5-carboxylate. InChIKey: CSFVHSINOYLNEF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 6-hydroxy-1H-indazole-5-carboxylate |
| InChIKey | CSFVHSINOYLNEF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C(=C1)C=NN2)O |
Computed by PubChem (NCBI)