Products 518990-36-8
CAS 518990-36-8 appears in our catalog under these names: 6-Methoxy-1h-indazole-3-carboxylic acid, 96%, 6-Methoxy-1H-indazole-3-carboxylic acid 96%, 6-Methoxy-1H-indazole-3-carboxylic acid, 96%, 96%, 6-Methoxy-1H-indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
6-methoxy-1H-indazole-3-carboxylic acid (CAS 518990-36-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1H-indazole-3-carboxylic acid. InChIKey: NRJPGEXONZLCQP-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-1H-indazole-3-carboxylic acid |
| InChIKey | NRJPGEXONZLCQP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)