Products 2665660-98-8
CAS 2665660-98-8 is the registry number for N-(2-Chloro-5-fluoro-4-nitrophenyl)acetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
N-(2-chloro-5-fluoro-4-nitrophenyl)acetamide (CAS 2665660-98-8) is a chemical compound with the molecular formula C8H6ClFN2O3 and a molecular weight of 232.59 g/mol. IUPAC name: N-(2-chloro-5-fluoro-4-nitrophenyl)acetamide. InChIKey: JVJCQLUDGDQOCF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN2O3 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | N-(2-chloro-5-fluoro-4-nitrophenyl)acetamide |
| InChIKey | JVJCQLUDGDQOCF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)