CAS 95635-45-3 is the registry number for N-(4-Chloro-2-fluoro-5-nitrophenyl)acetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
N-(4-chloro-2-fluoro-5-nitrophenyl)acetamide (CAS 95635-45-3) is a chemical compound with the molecular formula C8H6ClFN2O3 and a molecular weight of 232.59 g/mol. IUPAC name: N-(4-chloro-2-fluoro-5-nitrophenyl)acetamide. InChIKey: QXPWQNJSUGIFPM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN2O3 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | N-(4-chloro-2-fluoro-5-nitrophenyl)acetamide |
| InChIKey | QXPWQNJSUGIFPM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)