CAS 379254-83-8 appears in our catalog under these names: 2-Chloro-n-(2-fluoro-5-nitrophenyl)acetamide, 95%, 2-Chloro-N-(2-fluoro-5-nitrophenyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g.
2-chloro-N-(2-fluoro-5-nitrophenyl)acetamide (CAS 379254-83-8) is a chemical compound with the molecular formula C8H6ClFN2O3 and a molecular weight of 232.59 g/mol. IUPAC name: 2-chloro-N-(2-fluoro-5-nitrophenyl)acetamide. InChIKey: BCDJZGSHZUVZCW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN2O3 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | 2-chloro-N-(2-fluoro-5-nitrophenyl)acetamide |
| InChIKey | BCDJZGSHZUVZCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])NC(=O)CCl)F |
Computed by PubChem (NCBI)