Products 2665663-19-2
CAS 2665663-19-2 is the registry number for ethyl 2-(2-chloropyrimidin-4-yl)propanoate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Ethyl 2-(2-chloropyrimidin-4-yl)propanoate (CAS 2665663-19-2) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: ethyl 2-(2-chloropyrimidin-4-yl)propanoate. InChIKey: MIGHKVZCOULQLC-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | ethyl 2-(2-chloropyrimidin-4-yl)propanoate |
| InChIKey | MIGHKVZCOULQLC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=NC(=NC=C1)Cl |
Computed by PubChem (NCBI)