Products 2665671-75-8
CAS 2665671-75-8 is the registry number for 5-Amino-2,2-dimethylbenzo[b]thiophen-3(2H)-one 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-2,2-dimethyl-1,1-dioxo-1-benzothiophen-3-one (CAS 2665671-75-8) is a chemical compound with the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. IUPAC name: 5-amino-2,2-dimethyl-1,1-dioxo-1-benzothiophen-3-one. InChIKey: GVOZTKHIQSRFQZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 5-amino-2,2-dimethyl-1,1-dioxo-1-benzothiophen-3-one |
| InChIKey | GVOZTKHIQSRFQZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2=C(S1(=O)=O)C=CC(=C2)N)C |
Computed by PubChem (NCBI)