CAS 26674-05-5 is the registry number for Sodium Cromoglicate Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
(2-acetyl-3-hydroxyphenyl) acetate (CAS 26674-05-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (2-acetyl-3-hydroxyphenyl) acetate. InChIKey: FYAUIMDHUAKCPA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2-acetyl-3-hydroxyphenyl) acetate |
| InChIKey | FYAUIMDHUAKCPA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC=C1OC(=O)C)O |
Computed by PubChem (NCBI)