CAS 267225-27-4 appears in our catalog under these names: (R)–2–Amino–3–(2–bromophenyl)propanoic acid, 2-Bromo-D-phenylalanine, D-2-Bromophenylalanine, 98%, 98%, 2-Bromo-D-phenylalanine, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 0,1kg, 250mg, 1g, 500g.
(2R)-2-amino-3-(2-bromophenyl)propanoic acid (CAS 267225-27-4) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (2R)-2-amino-3-(2-bromophenyl)propanoic acid. InChIKey: JFVLNTLXEZDFHW-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-bromophenyl)propanoic acid |
| InChIKey | JFVLNTLXEZDFHW-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)Br |
Computed by PubChem (NCBI)