Products 2672496-88-5
CAS 2672496-88-5 is the registry number for Methyl 2-hydroxy-2-methyl-3-(methylsulfonyl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-hydroxy-2-methyl-3-methylsulfonylpropanoate (CAS 2672496-88-5) is a chemical compound with the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. IUPAC name: methyl 2-hydroxy-2-methyl-3-methylsulfonylpropanoate. InChIKey: NOHFWGNKYJMBDP-UHFFFAOYSA-N.
| Molecular formula | C6H12O5S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | methyl 2-hydroxy-2-methyl-3-methylsulfonylpropanoate |
| InChIKey | NOHFWGNKYJMBDP-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C)(C(=O)OC)O |
Computed by PubChem (NCBI)