CAS 7211-44-1 is the registry number for (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanethial, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial (CAS 7211-44-1) is a chemical compound with the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. IUPAC name: (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial. InChIKey: ABXYOVCSAGTJAC-JGWLITMVSA-N.
| Molecular formula | C6H12O5S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial |
| InChIKey | ABXYOVCSAGTJAC-JGWLITMVSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=S)O)O)O)O)O |
Computed by PubChem (NCBI)