CAS 49858-49-3 appears in our catalog under these names: (2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-6-mercaptotetrahydro-2H-pyran-3,4,5-triol, 98%, b-D-Thiogalactose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 25mg.
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol (CAS 49858-49-3) is a chemical compound with the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol. InChIKey: JUSMHIGDXPKSID-PHYPRBDBSA-N.
| Molecular formula | C6H12O5S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-sulfanyloxane-3,4,5-triol |
| InChIKey | JUSMHIGDXPKSID-PHYPRBDBSA-N |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)S)O)O)O)O |
Computed by PubChem (NCBI)