Products 2673269-93-5
CAS 2673269-93-5 is the registry number for (S)-1-phenylethanamine (R)-2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]acetic acid;(1S)-1-phenylethanamine (CAS 2673269-93-5) is a chemical compound with the molecular formula C18H21NO4 and a molecular weight of 315.4 g/mol. IUPAC name: 2-[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]acetic acid;(1S)-1-phenylethanamine. InChIKey: DCLWRXYFJCMXEE-NMNGKWJYSA-N.
| Molecular formula | C18H21NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]acetic acid;(1S)-1-phenylethanamine |
| InChIKey | DCLWRXYFJCMXEE-NMNGKWJYSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N.C1[C@@H](C2=C(O1)C=C(C=C2)O)CC(=O)O |
Computed by PubChem (NCBI)