Products 2676863-74-2
CAS 2676863-74-2 is the registry number for 7-Amino-6-cyclopropyl-2,3-dihydro-1H-indene-4-carbonitrile, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
7-amino-6-cyclopropyl-2,3-dihydro-1H-indene-4-carbonitrile (CAS 2676863-74-2) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 7-amino-6-cyclopropyl-2,3-dihydro-1H-indene-4-carbonitrile. InChIKey: AOHYNCGHNGVLLY-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 7-amino-6-cyclopropyl-2,3-dihydro-1H-indene-4-carbonitrile |
| InChIKey | AOHYNCGHNGVLLY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C(C=C2C#N)C3CC3)N |
Computed by PubChem (NCBI)