Products 2676867-54-0
CAS 2676867-54-0 is the registry number for 2-Fluoro-8-nitro-3,5,6,7-tetrahydro-s-indacen-1(2H)-one, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-fluoro-8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one (CAS 2676867-54-0) is a chemical compound with the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. IUPAC name: 2-fluoro-8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one. InChIKey: YFQDXHODXTURHY-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO3 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | 2-fluoro-8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one |
| InChIKey | YFQDXHODXTURHY-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C(=O)C(C3)F)C(=C2C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)