CAS 2677885-75-3 is the registry number for 2-Oxo-1,2-dihydro-1,6-naphthyridine-7-carbonitrile, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-oxo-1H-1,6-naphthyridine-7-carbonitrile (CAS 2677885-75-3) is a chemical compound with the molecular formula C9H5N3O and a molecular weight of 171.16 g/mol. IUPAC name: 2-oxo-1H-1,6-naphthyridine-7-carbonitrile. InChIKey: GCOFTITZZQZNPR-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 2-oxo-1H-1,6-naphthyridine-7-carbonitrile |
| InChIKey | GCOFTITZZQZNPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C1C=NC(=C2)C#N |
Computed by PubChem (NCBI)