CAS 595567-06-9 is the registry number for 4-(1,3,4-Oxadiazol-2-yl)benzonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(1,3,4-oxadiazol-2-yl)benzonitrile (CAS 595567-06-9) is a chemical compound with the molecular formula C9H5N3O and a molecular weight of 171.16 g/mol. IUPAC name: 4-(1,3,4-oxadiazol-2-yl)benzonitrile. InChIKey: UXAAKLFBYMIAOB-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 4-(1,3,4-oxadiazol-2-yl)benzonitrile |
| InChIKey | UXAAKLFBYMIAOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=NN=CO2 |
Computed by PubChem (NCBI)