CAS 2770504-14-6 is the registry number for 6-Oxo-5,6-dihydro-1,5-naphthyridine-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-oxo-5H-1,5-naphthyridine-4-carbonitrile (CAS 2770504-14-6) is a chemical compound with the molecular formula C9H5N3O and a molecular weight of 171.16 g/mol. IUPAC name: 6-oxo-5H-1,5-naphthyridine-4-carbonitrile. InChIKey: ONIJCLWILSXXNO-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 6-oxo-5H-1,5-naphthyridine-4-carbonitrile |
| InChIKey | ONIJCLWILSXXNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C=CN=C21)C#N |
Computed by PubChem (NCBI)