CAS 2680577-06-2 is the registry number for 1-Benzylindoline-4,6-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-2,3-dihydroindole-4,6-diol (CAS 2680577-06-2) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 1-benzyl-2,3-dihydroindole-4,6-diol. InChIKey: ZNNMYLLSQJYBLB-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 1-benzyl-2,3-dihydroindole-4,6-diol |
| InChIKey | ZNNMYLLSQJYBLB-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C(=CC(=C2)O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)