CAS 2680717-05-7 is the registry number for 3-(4-Amino-1-methyl-1H-indazol-3-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-amino-1-methylindazol-3-yl)piperidine-2,6-dione (CAS 2680717-05-7) is a chemical compound with the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. IUPAC name: 3-(4-amino-1-methylindazol-3-yl)piperidine-2,6-dione. InChIKey: JYWAVLQMPZLWTN-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O2 |
|---|---|
| Molecular weight | 258.28 g/mol |
| IUPAC name | 3-(4-amino-1-methylindazol-3-yl)piperidine-2,6-dione |
| InChIKey | JYWAVLQMPZLWTN-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC(=C2C(=N1)C3CCC(=O)NC3=O)N |
Computed by PubChem (NCBI)