CAS 937600-30-1 is the registry number for 3,6-Dicyclopropylisoxazolo(5,4-b)pyridine-4-carbohydrazide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide (CAS 937600-30-1) is a chemical compound with the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. IUPAC name: 3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide. InChIKey: CPWPVXHUPVKKAO-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O2 |
|---|---|
| Molecular weight | 258.28 g/mol |
| IUPAC name | 3,6-dicyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
| InChIKey | CPWPVXHUPVKKAO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(C(=C2)C(=O)NN)C(=NO3)C4CC4 |
Computed by PubChem (NCBI)