Products 595607-72-0
CAS 595607-72-0 appears in our catalog under these names: 2-(5-Azidopentyl)-1h-isoindole-1,3(2h)-dione, 95%, 2-(5-Azidopentyl)isoindoline-1,3-dione. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, Get quote.
2-(5-azidopentyl)isoindole-1,3-dione (CAS 595607-72-0) is a chemical compound with the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. IUPAC name: 2-(5-azidopentyl)isoindole-1,3-dione. InChIKey: VKDIHGHRTWHAJR-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O2 |
|---|---|
| Molecular weight | 258.28 g/mol |
| IUPAC name | 2-(5-azidopentyl)isoindole-1,3-dione |
| InChIKey | VKDIHGHRTWHAJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)