Products 26816-97-7
CAS 26816-97-7 is the registry number for N'-(3-Chlorophenyl)-n-hydroxy-n-methylurea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(3-chlorophenyl)-1-hydroxy-1-methylurea (CAS 26816-97-7) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 3-(3-chlorophenyl)-1-hydroxy-1-methylurea. InChIKey: UORPJSZMJXVSLI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1-hydroxy-1-methylurea |
| InChIKey | UORPJSZMJXVSLI-UHFFFAOYSA-N |
| SMILES | CN(C(=O)NC1=CC(=CC=C1)Cl)O |
Computed by PubChem (NCBI)