CAS 26819-11-4 is the registry number for N-Ethyl-3-nitrobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
N-ethyl-3-nitrobenzamide (CAS 26819-11-4) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: N-ethyl-3-nitrobenzamide. InChIKey: MEHSMNJKCAVTNH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | N-ethyl-3-nitrobenzamide |
| InChIKey | MEHSMNJKCAVTNH-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)