Products 2682112-43-0

CAS 2682112-43-0 is the registry number for Benzyl 3-(aminomethyl)morpholine-4-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 3-(aminomethyl)morpholine-4-carboxylate;hydrochloride (CAS 2682112-43-0) is a chemical compound with the molecular formula C13H19ClN2O3 and a molecular weight of 286.75 g/mol. IUPAC name: benzyl 3-(aminomethyl)morpholine-4-carboxylate;hydrochloride. InChIKey: CKKROMVDYCACLR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19ClN2O3
Molecular weight286.75 g/mol
IUPAC namebenzyl 3-(aminomethyl)morpholine-4-carboxylate;hydrochloride
InChIKeyCKKROMVDYCACLR-UHFFFAOYSA-N
SMILESC1COCC(N1C(=O)OCC2=CC=CC=C2)CN.Cl

Computed by PubChem (NCBI)