CAS 522628-95-1 is the registry number for 4-Chloro-N-(3-chloroquinoxalin-2-yl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-chloro-N-(3-chloroquinoxalin-2-yl)benzenesulfonamide (CAS 522628-95-1) is a chemical compound with the molecular formula C14H9Cl2N3O2S and a molecular weight of 354.2 g/mol. IUPAC name: 4-chloro-N-(3-chloroquinoxalin-2-yl)benzenesulfonamide. InChIKey: NHLDSWNAMMISMW-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2N3O2S |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | 4-chloro-N-(3-chloroquinoxalin-2-yl)benzenesulfonamide |
| InChIKey | NHLDSWNAMMISMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C(=N2)Cl)NS(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)