CAS 2687960-00-3 appears in our catalog under these names: Sodium D-Gluconate-13C6, >95% (HPLC), Gluconate-13C6 (sodium), 99.95%. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 25 mg, 10 mg, 50 mg, 100 mg, 5 mg.
Sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanoate (CAS 2687960-00-3) is a chemical compound with the molecular formula C6H11NaO7 and a molecular weight of 224.09 g/mol. IUPAC name: sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanoate. InChIKey: UPMFZISCCZSDND-BVKHNSGDSA-M.
| Molecular formula | C6H11NaO7 |
|---|---|
| Molecular weight | 224.09 g/mol |
| IUPAC name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanoate |
| InChIKey | UPMFZISCCZSDND-BVKHNSGDSA-M |
| SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C@H]([13C](=O)[O-])O)O)O)O)O.[Na+] |
Computed by PubChem (NCBI)