CAS 26893-17-4 appears in our catalog under these names: Ethyl 8-chloro[1,3]dioxolo[4,5-g]quinoline-7-carboxylate, 95%, Ethyl 8-chloro(1,3)dioxolo(4,5-g)quinoline-7-carboxylate. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 0,5g.
Ethyl 8-chloro-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate (CAS 26893-17-4) is a chemical compound with the molecular formula C13H10ClNO4 and a molecular weight of 279.67 g/mol. IUPAC name: ethyl 8-chloro-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate. InChIKey: IQDOHPSCFUSFGJ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4 |
|---|---|
| Molecular weight | 279.67 g/mol |
| IUPAC name | ethyl 8-chloro-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate |
| InChIKey | IQDOHPSCFUSFGJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC3=C(C=C2N=C1)OCO3)Cl |
Computed by PubChem (NCBI)