CAS 438590-44-4 appears in our catalog under these names: Dimethyl 6-chloroquinoline-2,4-dicarboxylate, 95%, dimethyl 6–chloroquinoline–2,4–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
Dimethyl 6-chloroquinoline-2,4-dicarboxylate (CAS 438590-44-4) is a chemical compound with the molecular formula C13H10ClNO4 and a molecular weight of 279.67 g/mol. IUPAC name: dimethyl 6-chloroquinoline-2,4-dicarboxylate. InChIKey: AFFRIWTUOYSJFU-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4 |
|---|---|
| Molecular weight | 279.67 g/mol |
| IUPAC name | dimethyl 6-chloroquinoline-2,4-dicarboxylate |
| InChIKey | AFFRIWTUOYSJFU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC2=C1C=C(C=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)