Products 708238-38-4
CAS 708238-38-4 is the registry number for 2-chloro-1-(3-methoxyphenoxy)-4-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1-(3-methoxyphenoxy)-4-nitrobenzene (CAS 708238-38-4) is a chemical compound with the molecular formula C13H10ClNO4 and a molecular weight of 279.67 g/mol. IUPAC name: 2-chloro-1-(3-methoxyphenoxy)-4-nitrobenzene. InChIKey: ZHLCRULMLJQLFT-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4 |
|---|---|
| Molecular weight | 279.67 g/mol |
| IUPAC name | 2-chloro-1-(3-methoxyphenoxy)-4-nitrobenzene |
| InChIKey | ZHLCRULMLJQLFT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OC2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)