CAS 26905-40-8 appears in our catalog under these names: 3–Methoxybenzylmagnesium chloride, 3-Methoxybenzylmagnesium chloride, 0.25M solution in THF, AcroSeal®, 3-METHOXYBENZYLMAGNESIUM CHLORIDE, 0.25&. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 50ml.
Magnesium;1-methanidyl-3-methoxybenzene;chloride (CAS 26905-40-8) is a chemical compound with the molecular formula C8H9ClMgO and a molecular weight of 180.91 g/mol. IUPAC name: magnesium;1-methanidyl-3-methoxybenzene;chloride. InChIKey: FKRZJHINSOKNDI-UHFFFAOYSA-M.
| Molecular formula | C8H9ClMgO |
|---|---|
| Molecular weight | 180.91 g/mol |
| IUPAC name | magnesium;1-methanidyl-3-methoxybenzene;chloride |
| InChIKey | FKRZJHINSOKNDI-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC(=C1)[CH2-].[Mg+2].[Cl-] |
Computed by PubChem (NCBI)