CAS 38769-92-5 appears in our catalog under these names: 4-Methoxybenzylmagnesium chloride, 0.25M in 2-MeTHF , 4-METHOXYBENZYLMAGNESIUM CHLORIDE, 0.25&. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
Magnesium;1-methanidyl-4-methoxybenzene;chloride (CAS 38769-92-5) is a chemical compound with the molecular formula C8H9ClMgO and a molecular weight of 180.91 g/mol. IUPAC name: magnesium;1-methanidyl-4-methoxybenzene;chloride. InChIKey: UDWJEJINASVQGJ-UHFFFAOYSA-M.
| Molecular formula | C8H9ClMgO |
|---|---|
| Molecular weight | 180.91 g/mol |
| IUPAC name | magnesium;1-methanidyl-4-methoxybenzene;chloride |
| InChIKey | UDWJEJINASVQGJ-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)[CH2-].[Mg+2].[Cl-] |
Computed by PubChem (NCBI)