CAS 480438-46-8 appears in our catalog under these names: 2–Methoxybenzylmagnesium chloride, 2-Methoxybenzylmagnesium chloride, 0.25M in 2-MeTHF . Offered by: GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100ml.
Magnesium;1-methanidyl-2-methoxybenzene;chloride (CAS 480438-46-8) is a chemical compound with the molecular formula C8H9ClMgO and a molecular weight of 180.91 g/mol. IUPAC name: magnesium;1-methanidyl-2-methoxybenzene;chloride. InChIKey: CCNUBJUSQCADGU-UHFFFAOYSA-M.
| Molecular formula | C8H9ClMgO |
|---|---|
| Molecular weight | 180.91 g/mol |
| IUPAC name | magnesium;1-methanidyl-2-methoxybenzene;chloride |
| InChIKey | CCNUBJUSQCADGU-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC=C1[CH2-].[Mg+2].[Cl-] |
Computed by PubChem (NCBI)