Products 2691846-93-0
CAS 2691846-93-0 appears in our catalog under these names: Sortilin antagonist 1, Sortilin antagonist 1, 99.63%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50 mg, 25 mg, 10 mg, 5 mg, 100 mg.
(2S)-5,5-dimethyl-2-[(6-phenoxypyridine-3-carbonyl)amino]hexanoic acid (CAS 2691846-93-0) is a chemical compound with the molecular formula C20H24N2O4 and a molecular weight of 356.4 g/mol. IUPAC name: (2S)-5,5-dimethyl-2-[(6-phenoxypyridine-3-carbonyl)amino]hexanoic acid. InChIKey: OWESOSHRVQOBOS-INIZCTEOSA-N.
| Molecular formula | C20H24N2O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2S)-5,5-dimethyl-2-[(6-phenoxypyridine-3-carbonyl)amino]hexanoic acid |
| InChIKey | OWESOSHRVQOBOS-INIZCTEOSA-N |
| SMILES | CC(C)(C)CC[C@@H](C(=O)O)NC(=O)C1=CN=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Sortilin antagonist 1, orb1744919