Products 2889422-86-8
CAS 2889422-86-8 appears in our catalog under these names: (R)–Sortilin antagonist 1, (R)-Sortilin antagonist 1, 97.05%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg, 10 mg.
(2R)-5,5-dimethyl-2-[(6-phenoxypyridine-3-carbonyl)amino]hexanoic acid (CAS 2889422-86-8) is a chemical compound with the molecular formula C20H24N2O4 and a molecular weight of 356.4 g/mol. IUPAC name: (2R)-5,5-dimethyl-2-[(6-phenoxypyridine-3-carbonyl)amino]hexanoic acid. InChIKey: OWESOSHRVQOBOS-MRXNPFEDSA-N.
| Molecular formula | C20H24N2O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2R)-5,5-dimethyl-2-[(6-phenoxypyridine-3-carbonyl)amino]hexanoic acid |
| InChIKey | OWESOSHRVQOBOS-MRXNPFEDSA-N |
| SMILES | CC(C)(C)CC[C@H](C(=O)O)NC(=O)C1=CN=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(R)-Sortilin antagonist 1, orb2646032